|
Trade Verify
Address: Hefei Circular Economy Demonstration Park, Feidong County, Hefei, Anhui, China
Contact name:Jinlong Huang
Anhui Fengle Agrochemical Co., Ltd. |
|
Verified Suppliers
|
|
|
| Isomerism | - |
| Chemical formula | C13H6Br2F6N2O2S |
| Canonical SMILES | CC1=NC(=C(S1)C(=O)NC2=C(C=C(C=C2Br)OC(F)(F)F)Br)C(F)(F)F |
| Isomeric SMILES | No data |
| International Chemical Identifier key (InChIKey) | WOSNCVAPUOFXEH-UHFFFAOYSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C13H6Br2F6N2O2S/c1-4-22-10(12(16,17)18)9(26-4)11(24)23-8-6(14)2-5(3-7(8)15)25-13(19,20)21/h2-3H,1H3,(H,23,24) |
General status:
| Pesticide type | Fungicide |
| Substance group | Carboxamide |
| Minimum active substance purity | - |
| Known relevant impurities | - |
| Substance origin | Synthetic |
| Mode of action | Systemic, absorbed by roots and translocated, inhibits succinate dehydrogenase in the tricarboxylic acid cycle |
| CAS RN | 130000-40-7 |
| EC number | - |
| CIPAC number | None allocated |
| US EPA chemical code | - |
| PubChem CID | 86389 |
| Molecular mass (g mol-1) | 528.06 |
| PIN (Preferred Identification Name) | N-[2,6-dibromo-4-(trifluoromethoxy)phenyl]-2-methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide |
| IUPAC name | 2',6'-dibromo-2-methyl-4'-trifluoromethoxy-4-trifluoromethyl-1,3-thiazole-5-carboxanilide |
| CAS name | N-(2,6-dibromo-4-(trifluoromethoxy)phenyl)-2-methyl-4-(trifluoromethyl)-5-thiazolecarboxamide |
