Security X-Ray Baggage Inspection System

X-ray Baggage Inspection System For Airport Cargo Screening

General Specification of x-ray scanner equipment:

1. Tunnel Size: 1000(W)*800(H)mm
2. Conveyor Speed: 0.22m/s
3. Conveyor Max Load: 200kg
4. Dose per Inspection<1.7μGy/h
5. Resolution< 0.101mm Copper Wire
6. Spatial resolution: Level: dia1.3mm, Vertical: dia1.0mm
7. Penetrate  resolution: Dia 0.511mm
8. Penetration: 40 mm Steel
9. Film Safety: Guarantee ISO1600 Film
10. X-ray Leakage <0.1 μGy/h (at a distance of 5cm From external housing)

X-ray Generator of x-ray scanner equipment

1. Generate direct: Downward
2. Generate anger: 80 degree
3. Anode Voltage: 100~160Kv
4. Anode power: 0.4 to 1.2mA
5. Cooling / Duty Cycle: Oil Cooling /100%

Image System of x-ray scanner equipment

1. X-ray Sensor: L-Shaped Photodiode Array (multi-energetic) , 12bit Deep
2. Monitor: High Resolution Color, LCD Accord, 17 inch
3. Image Processing: Edge enhancement, image strengthening, image lightening,,                  reducing  darkening, image returning, image retrieval.
4. Image Grey Level: 4096
5. Image Max Resolution: 1024 * 1280pixel
6. Image Processing: 24bit for processing real time
7. Image storage: Storage 60000 pictures in real time
8. Zones & Zoom: 1-9 Image regions, 2,4,8,16 Times Enlarge, Whole screen continuous observation
9. Multi-energetic distinguish objects: organic objects in orange, inorganic objects in blue,  mixture in green
10. High-energy/low energy : switch from high energy to low energy
11. Assist to detect drug and explosive powder

Installation Data of x-ray scanner equipment

1. Operation temperature/Humidity: 0°C-45°C/20%-95%(non-condensing)
2. Storage Temperature/Humidity: -20°C-60°C/20%-95%(non-condensing)
3. Operation Power: 220VAC(±10%)50±3Hz
4. Power Consumption: 1.0 KW (max), 1.0KW(working)
5. Noise: <58db